C31H50Si — CID 162285225
bis(2,3,4,5,6,7-hexamethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-methylsilane (PubChem CID 162285225) has the molecular formula C31H50Si and a molecular weight of 450.83 g/mol. Its IUPAC name is bis(2,3,4,5,6,7-hexamethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-methylsilane.
| Compound Name | bis(2,3,4,5,6,7-hexamethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-methylsilane |
|---|---|
| PubChem CID | 162285225 |
| Molecular Formula | C31H50Si |
| Molecular Weight | 450.83 g/mol |
| Exact Mass | 450.37 |
| IUPAC Name | bis(2,3,4,5,6,7-hexamethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-methylsilane |
| SMILES | CC1=C(C)C2C(C)C(C)C([SiH](C)C3C(C)C(C)C4C(C)=C(C)C(C)=C(C)C43)C2C(C)=C1C |
| InChI | InChI=1S/C31H50Si/c1-14-16(3)20(7)28-26(18(14)5)22(9)24(11)30(28)32(13)31-25(12)23(10)27-19(6)15(2)17(4)21(8)29(27)31/h22-32H,1-13H3 |
| InChIKey | HJQMNRGZMSLVKY-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.83 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|