C13H16O3Re — CID 155885990
carbon monoxide;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;rhenium (PubChem CID 155885990) has the molecular formula C13H16O3Re and a molecular weight of 406.48 g/mol. Its IUPAC name is carbon monoxide;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;rhenium.
| Compound Name | carbon monoxide;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;rhenium |
|---|---|
| PubChem CID | 155885990 |
| Molecular Formula | C13H16O3Re |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | carbon monoxide;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;rhenium |
| SMILES | CC1=C(C)C(C)C(C)=C1C.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Re] |
| InChI | InChI=1S/C10H16.3CO.Re/c1-6-7(2)9(4)10(5)8(6)3;3*1-2;/h6H,1-5H3;;;; |
| InChIKey | FHTLYWQTOMRUCW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 59.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|