About 2-hydroxy-3,4,5,6-tetramethylcyclohexa-2,5-dien-1-one
2-hydroxy-3,4,5,6-tetramethylcyclohexa-2,5-dien-1-one (PubChem CID 118968445) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-hydroxy-3,4,5,6-tetramethylcyclohexa-2,5-dien-1-one.
Analyze 2-hydroxy-3,4,5,6-tetramethylcyclohexa-2,5-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3,4,5,6-tetramethylcyclohexa-2,5-dien-1-one?
The IUPAC name of 2-hydroxy-3,4,5,6-tetramethylcyclohexa-2,5-dien-1-one (CID 118968445) is 2-hydroxy-3,4,5,6-tetramethylcyclohexa-2,5-dien-1-one.
What is the SMILES notation for 2-hydroxy-3,4,5,6-tetramethylcyclohexa-2,5-dien-1-one?
The canonical SMILES for 2-hydroxy-3,4,5,6-tetramethylcyclohexa-2,5-dien-1-one is CC1=C(C)C(C)C(C)=C(O)C1=O.
What is the InChIKey of 2-hydroxy-3,4,5,6-tetramethylcyclohexa-2,5-dien-1-one?
The InChIKey is GBZAJAVPHIJTRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c1-5-6(2)8(4)10(12)9(11)7(5)3/h5,11H,1-4H3.
What are the key properties of 2-hydroxy-3,4,5,6-tetramethylcyclohexa-2,5-dien-1-one?
2-hydroxy-3,4,5,6-tetramethylcyclohexa-2,5-dien-1-one has a molecular weight of 166.22 g/mol, XLogP of 2.37, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3,4,5,6-tetramethylcyclohexa-2,5-dien-1-one is sourced from PubChem (CID 118968445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).