C12H16O2 — CID 45098714
2-hydroxy-3,4-dimethyl-5-(3-methylbut-1-enylidene)cyclopent-2-en-1-one (PubChem CID 45098714) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-hydroxy-3,4-dimethyl-5-(3-methylbut-1-enylidene)cyclopent-2-en-1-one.
| Compound Name | 2-hydroxy-3,4-dimethyl-5-(3-methylbut-1-enylidene)cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 45098714 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 2-hydroxy-3,4-dimethyl-5-(3-methylbut-1-enylidene)cyclopent-2-en-1-one |
| SMILES | CC1=C(O)C(=O)C(=C=CC(C)C)C1C |
| InChI | InChI=1S/C12H16O2/c1-7(2)5-6-10-8(3)9(4)11(13)12(10)14/h5,7-8,13H,1-4H3 |
| InChIKey | ZXHVVGMZPXBTQY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|