About Perezone
Perezone (PubChem CID 92964) has the molecular formula C15H20O3
and a molecular weight of 248.32 g/mol. Its IUPAC name is 3-hydroxy-5-methyl-2-[(2R)-6-methylhept-5-en-2-yl]cyclohexa-2,5-diene-1,4-dione.
Molecular Properties
| Compound Name | Perezone |
| PubChem CID | 92964 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 3-hydroxy-5-methyl-2-[(2R)-6-methylhept-5-en-2-yl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=CC(=O)C(=C(C1=O)O)[C@H](C)CCC=C(C)C |
| InChI | InChI=1S/C15H20O3/c1-9(2)6-5-7-10(3)13-12(16)8-11(4)14(17)15(13)18/h6,8,10,18H,5,7H2,1-4H3/t10-/m1/s1 |
| InChIKey | JZXORCGMYQZBBQ-SNVBAGLBSA-N |
| XLogP | 3.40 |
| TPSA | 54.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | 460 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze Perezone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Perezone?
The IUPAC name of Perezone (CID 92964) is 3-hydroxy-5-methyl-2-[(2R)-6-methylhept-5-en-2-yl]cyclohexa-2,5-diene-1,4-dione.
What is the SMILES notation for Perezone?
The canonical SMILES for Perezone is CC1=CC(=O)C(=C(C1=O)O)[C@H](C)CCC=C(C)C.
What is the InChIKey of Perezone?
The InChIKey is JZXORCGMYQZBBQ-SNVBAGLBSA-N. The full InChI is InChI=1S/C15H20O3/c1-9(2)6-5-7-10(3)13-12(16)8-11(4)14(17)15(13)18/h6,8,10,18H,5,7H2,1-4H3/t10-/m1/s1.
What are the key properties of Perezone?
Perezone has a molecular weight of 248.32 g/mol, XLogP of 3.40, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Perezone is sourced from PubChem (CID 92964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).