C8H14 — CID 15050868
(3R,4R)-1,2,3,4-tetramethylcyclobutene (PubChem CID 15050868) has the molecular formula C8H14 and a molecular weight of 110.20 g/mol. Its IUPAC name is (3R,4R)-1,2,3,4-tetramethylcyclobutene.
| Compound Name | (3R,4R)-1,2,3,4-tetramethylcyclobutene |
|---|---|
| PubChem CID | 15050868 |
| Molecular Formula | C8H14 |
| Molecular Weight | 110.20 g/mol |
| Exact Mass | 110.11 |
| IUPAC Name | (3R,4R)-1,2,3,4-tetramethylcyclobutene |
| SMILES | CC1=C(C)[C@H](C)[C@H]1C |
| InChI | InChI=1S/C8H14/c1-5-6(2)8(4)7(5)3/h5-6H,1-4H3/t5-,6-/m1/s1 |
| InChIKey | YBYPDQPOSUFAHC-PHDIDXHHSA-N |
| XLogP | 2.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.20 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|