C18H26 — CID 123942516
9-tert-butyl-10-ethenyltetracyclo[6.2.1.13,6.02,7]dodec-4-ene (PubChem CID 123942516) has the molecular formula C18H26 and a molecular weight of 242.41 g/mol. Its IUPAC name is 9-tert-butyl-10-ethenyltetracyclo[6.2.1.13,6.02,7]dodec-4-ene.
| Compound Name | 9-tert-butyl-10-ethenyltetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
|---|---|
| PubChem CID | 123942516 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 9-tert-butyl-10-ethenyltetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
| SMILES | C=CC1C2CC(C3C4C=CC(C4)C23)C1C(C)(C)C |
| InChI | InChI=1S/C18H26/c1-5-12-13-9-14(17(12)18(2,3)4)16-11-7-6-10(8-11)15(13)16/h5-7,10-17H,1,8-9H2,2-4H3 |
| InChIKey | NWYGNLQCTHIATO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|