C17H21NO2 — CID 102083542
[(1R,2S,3S,4S)-3-tert-butyl-2-bicyclo[2.2.1]hept-5-enyl]-(1-oxidopyridin-1-ium-2-yl)methanone (PubChem CID 102083542) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is [(1R,2S,3S,4S)-3-tert-butyl-2-bicyclo[2.2.1]hept-5-enyl]-(1-oxidopyridin-1-ium-2-yl)methanone.
| Compound Name | [(1R,2S,3S,4S)-3-tert-butyl-2-bicyclo[2.2.1]hept-5-enyl]-(1-oxidopyridin-1-ium-2-yl)methanone |
|---|---|
| PubChem CID | 102083542 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | [(1R,2S,3S,4S)-3-tert-butyl-2-bicyclo[2.2.1]hept-5-enyl]-(1-oxidopyridin-1-ium-2-yl)methanone |
| SMILES | CC(C)(C)[C@@H]1[C@@H](C(=O)c2cccc[n+]2[O-])[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C17H21NO2/c1-17(2,3)15-12-8-7-11(10-12)14(15)16(19)13-6-4-5-9-18(13)20/h4-9,11-12,14-15H,10H2,1-3H3/t11-,12+,14-,15-/m0/s1 |
| InChIKey | QDIFKMMWHOYTHB-NEBZKDRISA-N |
| XLogP | 2.99 |
| TPSA | 44.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|