C21H20N2O2 — CID 10314708
[(1S,5R)-7-benzoyl-6,7-diazabicyclo[3.2.2]non-8-en-6-yl]-phenylmethanone (PubChem CID 10314708) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is [(1S,5R)-7-benzoyl-6,7-diazabicyclo[3.2.2]non-8-en-6-yl]-phenylmethanone.
| Compound Name | [(1S,5R)-7-benzoyl-6,7-diazabicyclo[3.2.2]non-8-en-6-yl]-phenylmethanone |
|---|---|
| PubChem CID | 10314708 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | [(1S,5R)-7-benzoyl-6,7-diazabicyclo[3.2.2]non-8-en-6-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1[C@@H]2C=C[C@@H](CCC2)N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H20N2O2/c24-20(16-8-3-1-4-9-16)22-18-12-7-13-19(15-14-18)23(22)21(25)17-10-5-2-6-11-17/h1-6,8-11,14-15,18-19H,7,12-13H2/t18-,19+ |
| InChIKey | NNQQXAKGCIPLRG-KDURUIRLSA-N |
| XLogP | 3.68 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|