C21H19P — CID 23419575
(1R,2S,3S,6R,7R,8S)-15-phenyl-15-phosphapentacyclo[6.6.1.13,6.02,7.09,14]hexadeca-4,9,11,13-tetraene (PubChem CID 23419575) has the molecular formula C21H19P and a molecular weight of 302.36 g/mol. Its IUPAC name is (1R,2S,3S,6R,7R,8S)-15-phenyl-15-phosphapentacyclo[6.6.1.13,6.02,7.09,14]hexadeca-4,9,11,13-tetraene.
| Compound Name | (1R,2S,3S,6R,7R,8S)-15-phenyl-15-phosphapentacyclo[6.6.1.13,6.02,7.09,14]hexadeca-4,9,11,13-tetraene |
|---|---|
| PubChem CID | 23419575 |
| Molecular Formula | C21H19P |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | (1R,2S,3S,6R,7R,8S)-15-phenyl-15-phosphapentacyclo[6.6.1.13,6.02,7.09,14]hexadeca-4,9,11,13-tetraene |
| SMILES | C1=C[C@H]2C[C@@H]1[C@H]1[C@@H]2[C@H]2c3ccccc3[C@@H]1P2c1ccccc1 |
| InChI | InChI=1S/C21H19P/c1-2-6-15(7-3-1)22-20-16-8-4-5-9-17(16)21(22)19-14-11-10-13(12-14)18(19)20/h1-11,13-14,18-21H,12H2/t13-,14+,18+,19-,20+,21-,22? |
| InChIKey | ALQDTRBKSPGCMK-GDARURMASA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|