C18H27P — CID 22459987
7-phenyl-2,5-di(propan-2-yl)-7-phosphabicyclo[2.2.1]heptane (PubChem CID 22459987) has the molecular formula C18H27P and a molecular weight of 274.39 g/mol. Its IUPAC name is 7-phenyl-2,5-di(propan-2-yl)-7-phosphabicyclo[2.2.1]heptane.
| Compound Name | 7-phenyl-2,5-di(propan-2-yl)-7-phosphabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 22459987 |
| Molecular Formula | C18H27P |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 7-phenyl-2,5-di(propan-2-yl)-7-phosphabicyclo[2.2.1]heptane |
| SMILES | CC(C)C1CC2C(C(C)C)CC1P2c1ccccc1 |
| InChI | InChI=1S/C18H27P/c1-12(2)15-10-18-16(13(3)4)11-17(15)19(18)14-8-6-5-7-9-14/h5-9,12-13,15-18H,10-11H2,1-4H3 |
| InChIKey | ORTAVBUVZUJDTB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|