C14H18Sn — CID 71544932
trimethyl-[(1S,8R)-11-tricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraenyl]stannane (PubChem CID 71544932) has the molecular formula C14H18Sn and a molecular weight of 305.01 g/mol. Its IUPAC name is trimethyl-[(1S,8R)-11-tricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraenyl]stannane.
| Compound Name | trimethyl-[(1S,8R)-11-tricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraenyl]stannane |
|---|---|
| PubChem CID | 71544932 |
| Molecular Formula | C14H18Sn |
| Molecular Weight | 305.01 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | trimethyl-[(1S,8R)-11-tricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraenyl]stannane |
| SMILES | C[Sn](C)(C)C1[C@@H]2C=C[C@H]1c1ccccc12 |
| InChI | InChI=1S/C11H9.3CH3.Sn/c1-2-4-11-9-6-5-8(7-9)10(11)3-1;;;;/h1-9H;3*1H3;/t8-,9+;;;; |
| InChIKey | RQIUHYAVAXBGQZ-ZNPOZJMQSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.01 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|