C15H14 — CID 124910661
(1R,8R,9S,12S)-10-methyltetracyclo[6.4.2.02,7.09,12]tetradeca-2,4,6,10,13-pentaene (PubChem CID 124910661) has the molecular formula C15H14 and a molecular weight of 194.28 g/mol. Its IUPAC name is (1R,8R,9S,12S)-10-methyltetracyclo[6.4.2.02,7.09,12]tetradeca-2,4,6,10,13-pentaene.
| Compound Name | (1R,8R,9S,12S)-10-methyltetracyclo[6.4.2.02,7.09,12]tetradeca-2,4,6,10,13-pentaene |
|---|---|
| PubChem CID | 124910661 |
| Molecular Formula | C15H14 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | (1R,8R,9S,12S)-10-methyltetracyclo[6.4.2.02,7.09,12]tetradeca-2,4,6,10,13-pentaene |
| SMILES | CC1=C[C@H]2[C@H]1[C@H]1C=C[C@H]2c2ccccc21 |
| InChI | InChI=1S/C15H14/c1-9-8-14-12-6-7-13(15(9)14)11-5-3-2-4-10(11)12/h2-8,12-15H,1H3/t12-,13-,14+,15+/m0/s1 |
| InChIKey | WBOCXLAEZXUHRP-BYNSBNAKSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|