C34H40O4 — CID 139205920
(1S,2R,4S,11R,14S,18R)-3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadeca-5,7,9-trien-18-ol (PubChem CID 139205920) has the molecular formula C34H40O4 and a molecular weight of 512.69 g/mol. Its IUPAC name is (1S,2R,4S,11R,14S,18R)-3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadeca-5,7,9-trien-18-ol.
| Compound Name | (1S,2R,4S,11R,14S,18R)-3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadeca-5,7,9-trien-18-ol |
|---|---|
| PubChem CID | 139205920 |
| Molecular Formula | C34H40O4 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | (1S,2R,4S,11R,14S,18R)-3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadeca-5,7,9-trien-18-ol |
| SMILES | O[C@]12CCC[C@H]1CC[C@H]1c3ccccc3[C@@H]3O[C@@H]3[C@H]12.O[C@]12CCC[C@H]1CC[C@H]1c3ccccc3[C@@H]3O[C@@H]3[C@H]12 |
| InChI | InChI=1S/2C17H20O2/c2*18-17-9-3-4-10(17)7-8-12-11-5-1-2-6-13(11)15-16(19-15)14(12)17/h2*1-2,5-6,10,12,14-16,18H,3-4,7-9H2/t2*10-,12-,14-,15-,16+,17+/m00/s1 |
| InChIKey | BNWWYFTXQJNHDA-PFDZEFMASA-N |
| XLogP | 6.33 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|