1-methylsulfanyl-2,3-dihydroindene-1-carboxylic acid

C11H12O2S — CID 82235218

IUPAC1-methylsulfanyl-2,3-dihydroindene-1-carboxylic acid
SMILESCSC1(C(=O)O)CCc2ccccc21
InChIInChI=1S/C11H12O2S/c1-14-11(10(12)13)7-6-8-4-2-3-5-9(8)11/h2-5H,6-7H2,1H3,(H,12,13)
InChIKeyZHYKIGCGNPYIEF-UHFFFAOYSA-N
MW208.28 g/mol
LogP2.28
Rot. Bonds2

About 1-methylsulfanyl-2,3-dihydroindene-1-carboxylic acid

1-methylsulfanyl-2,3-dihydroindene-1-carboxylic acid (PubChem CID 82235218) has the molecular formula C11H12O2S and a molecular weight of 208.28 g/mol. Its IUPAC name is 1-methylsulfanyl-2,3-dihydroindene-1-carboxylic acid.

Molecular Properties

Compound Name1-methylsulfanyl-2,3-dihydroindene-1-carboxylic acid
PubChem CID82235218
Molecular FormulaC11H12O2S
Molecular Weight208.28 g/mol
Exact Mass208.06
IUPAC Name1-methylsulfanyl-2,3-dihydroindene-1-carboxylic acid
SMILESCSC1(C(=O)O)CCc2ccccc21
InChIInChI=1S/C11H12O2S/c1-14-11(10(12)13)7-6-8-4-2-3-5-9(8)11/h2-5H,6-7H2,1H3,(H,12,13)
InChIKeyZHYKIGCGNPYIEF-UHFFFAOYSA-N
XLogP2.28
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.28
LogP ≤ 52.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 1-methylsulfanyl-2,3-dihydroindene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-methylsulfanyl-2,3-dihydroindene-1-carboxylic acid?
The IUPAC name of 1-methylsulfanyl-2,3-dihydroindene-1-carboxylic acid (CID 82235218) is 1-methylsulfanyl-2,3-dihydroindene-1-carboxylic acid.
What is the SMILES notation for 1-methylsulfanyl-2,3-dihydroindene-1-carboxylic acid?
The canonical SMILES for 1-methylsulfanyl-2,3-dihydroindene-1-carboxylic acid is CSC1(C(=O)O)CCc2ccccc21.
What is the InChIKey of 1-methylsulfanyl-2,3-dihydroindene-1-carboxylic acid?
The InChIKey is ZHYKIGCGNPYIEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2S/c1-14-11(10(12)13)7-6-8-4-2-3-5-9(8)11/h2-5H,6-7H2,1H3,(H,12,13).
What are the key properties of 1-methylsulfanyl-2,3-dihydroindene-1-carboxylic acid?
1-methylsulfanyl-2,3-dihydroindene-1-carboxylic acid has a molecular weight of 208.28 g/mol, XLogP of 2.28, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylsulfanyl-2,3-dihydroindene-1-carboxylic acid is sourced from PubChem (CID 82235218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).