1-anilino-2,3-dihydroindene-1-carboxylic acid

C16H15NO2 — CID 12740130

IUPAC1-anilino-2,3-dihydroindene-1-carboxylic acid
SMILESO=C(O)C1(Nc2ccccc2)CCc2ccccc21
InChIInChI=1S/C16H15NO2/c18-15(19)16(17-13-7-2-1-3-8-13)11-10-12-6-4-5-9-14(12)16/h1-9,17H,10-11H2,(H,18,19)
InChIKeyYEOGRMMPERQCBD-UHFFFAOYSA-N
MW253.30 g/mol
LogP3.02
Rot. Bonds3

About 1-anilino-2,3-dihydroindene-1-carboxylic acid

1-anilino-2,3-dihydroindene-1-carboxylic acid (PubChem CID 12740130) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is 1-anilino-2,3-dihydroindene-1-carboxylic acid.

Molecular Properties

Compound Name1-anilino-2,3-dihydroindene-1-carboxylic acid
PubChem CID12740130
Molecular FormulaC16H15NO2
Molecular Weight253.30 g/mol
Exact Mass253.11
IUPAC Name1-anilino-2,3-dihydroindene-1-carboxylic acid
SMILESO=C(O)C1(Nc2ccccc2)CCc2ccccc21
InChIInChI=1S/C16H15NO2/c18-15(19)16(17-13-7-2-1-3-8-13)11-10-12-6-4-5-9-14(12)16/h1-9,17H,10-11H2,(H,18,19)
InChIKeyYEOGRMMPERQCBD-UHFFFAOYSA-N
XLogP3.02
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.30
LogP ≤ 53.02
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 1-anilino-2,3-dihydroindene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-anilino-2,3-dihydroindene-1-carboxylic acid?
The IUPAC name of 1-anilino-2,3-dihydroindene-1-carboxylic acid (CID 12740130) is 1-anilino-2,3-dihydroindene-1-carboxylic acid.
What is the SMILES notation for 1-anilino-2,3-dihydroindene-1-carboxylic acid?
The canonical SMILES for 1-anilino-2,3-dihydroindene-1-carboxylic acid is O=C(O)C1(Nc2ccccc2)CCc2ccccc21.
What is the InChIKey of 1-anilino-2,3-dihydroindene-1-carboxylic acid?
The InChIKey is YEOGRMMPERQCBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO2/c18-15(19)16(17-13-7-2-1-3-8-13)11-10-12-6-4-5-9-14(12)16/h1-9,17H,10-11H2,(H,18,19).
What are the key properties of 1-anilino-2,3-dihydroindene-1-carboxylic acid?
1-anilino-2,3-dihydroindene-1-carboxylic acid has a molecular weight of 253.30 g/mol, XLogP of 3.02, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-anilino-2,3-dihydroindene-1-carboxylic acid is sourced from PubChem (CID 12740130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).