C11H12O2S — CID 71385563
1-methyl-3,4-dihydroisothiochromene-1-carboxylic acid (PubChem CID 71385563) has the molecular formula C11H12O2S and a molecular weight of 208.28 g/mol. Its IUPAC name is 1-methyl-3,4-dihydroisothiochromene-1-carboxylic acid.
| Compound Name | 1-methyl-3,4-dihydroisothiochromene-1-carboxylic acid |
|---|---|
| PubChem CID | 71385563 |
| Molecular Formula | C11H12O2S |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 1-methyl-3,4-dihydroisothiochromene-1-carboxylic acid |
| SMILES | CC1(C(=O)O)SCCc2ccccc21 |
| InChI | InChI=1S/C11H12O2S/c1-11(10(12)13)9-5-3-2-4-8(9)6-7-14-11/h2-5H,6-7H2,1H3,(H,12,13) |
| InChIKey | ZNTUOUSNZUVNQV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |