C11H13NO2 — CID 129027598
(1R)-N-hydroxy-1-methyl-2,3-dihydroindene-1-carboxamide (PubChem CID 129027598) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is (1R)-N-hydroxy-1-methyl-2,3-dihydroindene-1-carboxamide.
| Compound Name | (1R)-N-hydroxy-1-methyl-2,3-dihydroindene-1-carboxamide |
|---|---|
| PubChem CID | 129027598 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | (1R)-N-hydroxy-1-methyl-2,3-dihydroindene-1-carboxamide |
| SMILES | C[C@@]1(C(=O)NO)CCc2ccccc21 |
| InChI | InChI=1S/C11H13NO2/c1-11(10(13)12-14)7-6-8-4-2-3-5-9(8)11/h2-5,14H,6-7H2,1H3,(H,12,13)/t11-/m1/s1 |
| InChIKey | XSTSKTLGIURXCC-LLVKDONJSA-N |
| XLogP | 1.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|