C19H19NO — CID 24846104
spiro[piperidine-5,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene]-2-one (PubChem CID 24846104) has the molecular formula C19H19NO and a molecular weight of 277.37 g/mol. Its IUPAC name is spiro[piperidine-5,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene]-2-one.
| Compound Name | spiro[piperidine-5,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene]-2-one |
|---|---|
| PubChem CID | 24846104 |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | spiro[piperidine-5,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene]-2-one |
| SMILES | O=C1CCC2(CN1)c1ccccc1CCc1ccccc12 |
| InChI | InChI=1S/C19H19NO/c21-18-11-12-19(13-20-18)16-7-3-1-5-14(16)9-10-15-6-2-4-8-17(15)19/h1-8H,9-13H2,(H,20,21) |
| InChIKey | AVZACRJBWWZTTM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |