C10H11NO — CID 115012660
spiro[1,2-dihydroisoindole-3,1'-cyclopropane]-4-ol (PubChem CID 115012660) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is spiro[1,2-dihydroisoindole-3,1'-cyclopropane]-4-ol.
| Compound Name | spiro[1,2-dihydroisoindole-3,1'-cyclopropane]-4-ol |
|---|---|
| PubChem CID | 115012660 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | spiro[1,2-dihydroisoindole-3,1'-cyclopropane]-4-ol |
| SMILES | Oc1cccc2c1C1(CC1)NC2 |
| InChI | InChI=1S/C10H11NO/c12-8-3-1-2-7-6-11-10(4-5-10)9(7)8/h1-3,11-12H,4-6H2 |
| InChIKey | NPIOXGIRSQBIQN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|