C11H14O3 — CID 117104102
2-(1-hydroxycyclopentyl)benzene-1,3-diol (PubChem CID 117104102) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-(1-hydroxycyclopentyl)benzene-1,3-diol.
| Compound Name | 2-(1-hydroxycyclopentyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 117104102 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 2-(1-hydroxycyclopentyl)benzene-1,3-diol |
| SMILES | Oc1cccc(O)c1C1(O)CCCC1 |
| InChI | InChI=1S/C11H14O3/c12-8-4-3-5-9(13)10(8)11(14)6-1-2-7-11/h3-5,12-14H,1-2,6-7H2 |
| InChIKey | IQYPGHTWGOAIEF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |