C24H24NP — CID 150467186
diphenyl-[(3S)-spiro[1,2-dihydroindene-3,2'-pyrrolidine]-4-yl]phosphane (PubChem CID 150467186) has the molecular formula C24H24NP and a molecular weight of 357.44 g/mol. Its IUPAC name is diphenyl-[(3S)-spiro[1,2-dihydroindene-3,2'-pyrrolidine]-4-yl]phosphane.
| Compound Name | diphenyl-[(3S)-spiro[1,2-dihydroindene-3,2'-pyrrolidine]-4-yl]phosphane |
|---|---|
| PubChem CID | 150467186 |
| Molecular Formula | C24H24NP |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | diphenyl-[(3S)-spiro[1,2-dihydroindene-3,2'-pyrrolidine]-4-yl]phosphane |
| SMILES | c1ccc(P(c2ccccc2)c2cccc3c2[C@@]2(CCCN2)CC3)cc1 |
| InChI | InChI=1S/C24H24NP/c1-3-10-20(11-4-1)26(21-12-5-2-6-13-21)22-14-7-9-19-15-17-24(23(19)22)16-8-18-25-24/h1-7,9-14,25H,8,15-18H2/t24-/m1/s1 |
| InChIKey | HRAMTXPEKPALBL-XMMPIXPASA-N |
| XLogP | 3.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|