About 1,1-dimethyl-3,4-dihydro-2H-isoquinoline;hydrochloride
1,1-dimethyl-3,4-dihydro-2H-isoquinoline;hydrochloride (PubChem CID 67224173) has the molecular formula C11H16ClN
and a molecular weight of 197.71 g/mol. Its IUPAC name is 1,1-dimethyl-3,4-dihydro-2H-isoquinoline;hydrochloride.
Molecular Properties
| Compound Name | 1,1-dimethyl-3,4-dihydro-2H-isoquinoline;hydrochloride |
| PubChem CID | 67224173 |
| Molecular Formula | C11H16ClN |
| Molecular Weight | 197.71 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 1,1-dimethyl-3,4-dihydro-2H-isoquinoline;hydrochloride |
| SMILES | CC1(C)NCCc2ccccc21.Cl |
| InChI | InChI=1S/C11H15N.ClH/c1-11(2)10-6-4-3-5-9(10)7-8-12-11;/h3-6,12H,7-8H2,1-2H3;1H |
| InChIKey | AUMAJLSUMHXAOC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.71 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,1-dimethyl-3,4-dihydro-2H-isoquinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethyl-3,4-dihydro-2H-isoquinoline;hydrochloride?
The IUPAC name of 1,1-dimethyl-3,4-dihydro-2H-isoquinoline;hydrochloride (CID 67224173) is 1,1-dimethyl-3,4-dihydro-2H-isoquinoline;hydrochloride.
What is the SMILES notation for 1,1-dimethyl-3,4-dihydro-2H-isoquinoline;hydrochloride?
The canonical SMILES for 1,1-dimethyl-3,4-dihydro-2H-isoquinoline;hydrochloride is CC1(C)NCCc2ccccc21.Cl.
What is the InChIKey of 1,1-dimethyl-3,4-dihydro-2H-isoquinoline;hydrochloride?
The InChIKey is AUMAJLSUMHXAOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N.ClH/c1-11(2)10-6-4-3-5-9(10)7-8-12-11;/h3-6,12H,7-8H2,1-2H3;1H.
What are the key properties of 1,1-dimethyl-3,4-dihydro-2H-isoquinoline;hydrochloride?
1,1-dimethyl-3,4-dihydro-2H-isoquinoline;hydrochloride has a molecular weight of 197.71 g/mol, XLogP of 2.49, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethyl-3,4-dihydro-2H-isoquinoline;hydrochloride is sourced from PubChem (CID 67224173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).