C20H24Cl3NO3 — CID 10071497
2,2,2-trichloroethyl (4aR,10bR)-4a-methyl-10b-propanoyl-2,4,5,6-tetrahydro-1H-benzo[f]isoquinoline-3-carboxylate (PubChem CID 10071497) has the molecular formula C20H24Cl3NO3 and a molecular weight of 432.78 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (4aR,10bR)-4a-methyl-10b-propanoyl-2,4,5,6-tetrahydro-1H-benzo[f]isoquinoline-3-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (4aR,10bR)-4a-methyl-10b-propanoyl-2,4,5,6-tetrahydro-1H-benzo[f]isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 10071497 |
| Molecular Formula | C20H24Cl3NO3 |
| Molecular Weight | 432.78 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | 2,2,2-trichloroethyl (4aR,10bR)-4a-methyl-10b-propanoyl-2,4,5,6-tetrahydro-1H-benzo[f]isoquinoline-3-carboxylate |
| SMILES | CCC(=O)[C@@]12CCN(C(=O)OCC(Cl)(Cl)Cl)C[C@]1(C)CCc1ccccc12 |
| InChI | InChI=1S/C20H24Cl3NO3/c1-3-16(25)19-10-11-24(17(26)27-13-20(21,22)23)12-18(19,2)9-8-14-6-4-5-7-15(14)19/h4-7H,3,8-13H2,1-2H3/t18-,19-/m0/s1 |
| InChIKey | HRVDWBDHFGFWRD-OALUTQOASA-N |
| XLogP | 5.07 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.78 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|