C13H15Cl3N2O2 — CID 101452211
2,2,2-trichloroethyl 4-phenylpiperazine-1-carboxylate (PubChem CID 101452211) has the molecular formula C13H15Cl3N2O2 and a molecular weight of 337.63 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 4-phenylpiperazine-1-carboxylate.
| Compound Name | 2,2,2-trichloroethyl 4-phenylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 101452211 |
| Molecular Formula | C13H15Cl3N2O2 |
| Molecular Weight | 337.63 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 2,2,2-trichloroethyl 4-phenylpiperazine-1-carboxylate |
| SMILES | O=C(OCC(Cl)(Cl)Cl)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C13H15Cl3N2O2/c14-13(15,16)10-20-12(19)18-8-6-17(7-9-18)11-4-2-1-3-5-11/h1-5H,6-10H2 |
| InChIKey | PYEOMZCJLJGRRX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.63 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|