C17H15Cl3N2O2 — CID 59825532
(2,4,5-trichlorophenyl) 4-phenylpiperazine-1-carboxylate (PubChem CID 59825532) has the molecular formula C17H15Cl3N2O2 and a molecular weight of 385.68 g/mol. Its IUPAC name is (2,4,5-trichlorophenyl) 4-phenylpiperazine-1-carboxylate.
| Compound Name | (2,4,5-trichlorophenyl) 4-phenylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 59825532 |
| Molecular Formula | C17H15Cl3N2O2 |
| Molecular Weight | 385.68 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | (2,4,5-trichlorophenyl) 4-phenylpiperazine-1-carboxylate |
| SMILES | O=C(Oc1cc(Cl)c(Cl)cc1Cl)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C17H15Cl3N2O2/c18-13-10-15(20)16(11-14(13)19)24-17(23)22-8-6-21(7-9-22)12-4-2-1-3-5-12/h1-5,10-11H,6-9H2 |
| InChIKey | MWOOETYQDIKZHR-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.68 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|