C18H25N3O3 — CID 68903912
[1-(4-phenylpiperazine-1-carbonyl)cyclohexyl] carbamate (PubChem CID 68903912) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is [1-(4-phenylpiperazine-1-carbonyl)cyclohexyl] carbamate.
| Compound Name | [1-(4-phenylpiperazine-1-carbonyl)cyclohexyl] carbamate |
|---|---|
| PubChem CID | 68903912 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | [1-(4-phenylpiperazine-1-carbonyl)cyclohexyl] carbamate |
| SMILES | NC(=O)OC1(C(=O)N2CCN(c3ccccc3)CC2)CCCCC1 |
| InChI | InChI=1S/C18H25N3O3/c19-17(23)24-18(9-5-2-6-10-18)16(22)21-13-11-20(12-14-21)15-7-3-1-4-8-15/h1,3-4,7-8H,2,5-6,9-14H2,(H2,19,23) |
| InChIKey | MZQBBSODNQVTKI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |