C16H20O — CID 21433521
ethene;spiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one (PubChem CID 21433521) has the molecular formula C16H20O and a molecular weight of 228.33 g/mol. Its IUPAC name is ethene;spiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one.
| Compound Name | ethene;spiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one |
|---|---|
| PubChem CID | 21433521 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | ethene;spiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one |
| SMILES | C=C.O=C1CCC2(CC1)Cc1ccccc1C2 |
| InChI | InChI=1S/C14H16O.C2H4/c15-13-5-7-14(8-6-13)9-11-3-1-2-4-12(11)10-14;1-2/h1-4H,5-10H2;1-2H2 |
| InChIKey | HOVYSQAPSRXWHQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|