About (3S)-spiro[2,4-dihydro-1H-naphthalene-3,3'-cyclohexane]-1'-ol
(3S)-spiro[2,4-dihydro-1H-naphthalene-3,3'-cyclohexane]-1'-ol (PubChem CID 175705995) has the molecular formula C15H20O
and a molecular weight of 216.32 g/mol. Its IUPAC name is (3S)-spiro[2,4-dihydro-1H-naphthalene-3,3'-cyclohexane]-1'-ol.
Molecular Properties
| Compound Name | (3S)-spiro[2,4-dihydro-1H-naphthalene-3,3'-cyclohexane]-1'-ol |
| PubChem CID | 175705995 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (3S)-spiro[2,4-dihydro-1H-naphthalene-3,3'-cyclohexane]-1'-ol |
| SMILES | OC1CCC[C@@]2(CCc3ccccc3C2)C1 |
| InChI | InChI=1S/C15H20O/c16-14-6-3-8-15(11-14)9-7-12-4-1-2-5-13(12)10-15/h1-2,4-5,14,16H,3,6-11H2/t14?,15-/m0/s1 |
| InChIKey | ITHUSXKROXWOAR-LOACHALJSA-N |
| XLogP | 3.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3S)-spiro[2,4-dihydro-1H-naphthalene-3,3'-cyclohexane]-1'-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-spiro[2,4-dihydro-1H-naphthalene-3,3'-cyclohexane]-1'-ol?
The IUPAC name of (3S)-spiro[2,4-dihydro-1H-naphthalene-3,3'-cyclohexane]-1'-ol (CID 175705995) is (3S)-spiro[2,4-dihydro-1H-naphthalene-3,3'-cyclohexane]-1'-ol.
What is the SMILES notation for (3S)-spiro[2,4-dihydro-1H-naphthalene-3,3'-cyclohexane]-1'-ol?
The canonical SMILES for (3S)-spiro[2,4-dihydro-1H-naphthalene-3,3'-cyclohexane]-1'-ol is OC1CCC[C@@]2(CCc3ccccc3C2)C1.
What is the InChIKey of (3S)-spiro[2,4-dihydro-1H-naphthalene-3,3'-cyclohexane]-1'-ol?
The InChIKey is ITHUSXKROXWOAR-LOACHALJSA-N. The full InChI is InChI=1S/C15H20O/c16-14-6-3-8-15(11-14)9-7-12-4-1-2-5-13(12)10-15/h1-2,4-5,14,16H,3,6-11H2/t14?,15-/m0/s1.
What are the key properties of (3S)-spiro[2,4-dihydro-1H-naphthalene-3,3'-cyclohexane]-1'-ol?
(3S)-spiro[2,4-dihydro-1H-naphthalene-3,3'-cyclohexane]-1'-ol has a molecular weight of 216.32 g/mol, XLogP of 3.10, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-spiro[2,4-dihydro-1H-naphthalene-3,3'-cyclohexane]-1'-ol is sourced from PubChem (CID 175705995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).