C10H12FNO — CID 170294723
(5S,8S)-5-fluoro-5-methyl-7,8-dihydro-6H-quinolin-8-ol (PubChem CID 170294723) has the molecular formula C10H12FNO and a molecular weight of 181.21 g/mol. Its IUPAC name is (5S,8S)-5-fluoro-5-methyl-7,8-dihydro-6H-quinolin-8-ol.
| Compound Name | (5S,8S)-5-fluoro-5-methyl-7,8-dihydro-6H-quinolin-8-ol |
|---|---|
| PubChem CID | 170294723 |
| Molecular Formula | C10H12FNO |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | (5S,8S)-5-fluoro-5-methyl-7,8-dihydro-6H-quinolin-8-ol |
| SMILES | C[C@]1(F)CC[C@H](O)c2ncccc21 |
| InChI | InChI=1S/C10H12FNO/c1-10(11)5-4-8(13)9-7(10)3-2-6-12-9/h2-3,6,8,13H,4-5H2,1H3/t8-,10-/m0/s1 |
| InChIKey | IOEJKJFOXPUNPU-WPRPVWTQSA-N |
| XLogP | 2.09 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |