C18H15ClF3NO2 — CID 161192957
3-(2-chloro-4,5-difluorophenyl)-1-[(5S,8R)-5-fluoro-8-hydroxy-7,8-dihydro-6H-quinolin-5-yl]propan-1-one (PubChem CID 161192957) has the molecular formula C18H15ClF3NO2 and a molecular weight of 369.77 g/mol. Its IUPAC name is 3-(2-chloro-4,5-difluorophenyl)-1-[(5S,8R)-5-fluoro-8-hydroxy-7,8-dihydro-6H-quinolin-5-yl]propan-1-one.
| Compound Name | 3-(2-chloro-4,5-difluorophenyl)-1-[(5S,8R)-5-fluoro-8-hydroxy-7,8-dihydro-6H-quinolin-5-yl]propan-1-one |
|---|---|
| PubChem CID | 161192957 |
| Molecular Formula | C18H15ClF3NO2 |
| Molecular Weight | 369.77 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 3-(2-chloro-4,5-difluorophenyl)-1-[(5S,8R)-5-fluoro-8-hydroxy-7,8-dihydro-6H-quinolin-5-yl]propan-1-one |
| SMILES | O=C(CCc1cc(F)c(F)cc1Cl)[C@]1(F)CC[C@@H](O)c2ncccc21 |
| InChI | InChI=1S/C18H15ClF3NO2/c19-12-9-14(21)13(20)8-10(12)3-4-16(25)18(22)6-5-15(24)17-11(18)2-1-7-23-17/h1-2,7-9,15,24H,3-6H2/t15-,18+/m1/s1 |
| InChIKey | UTYVJRMGFBGDNF-QAPCUYQASA-N |
| XLogP | 4.21 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.77 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|