C21H20Cl2FNO2 — CID 160989894
3-(2,4-dichlorophenyl)-1-[(5S,8S)-5-fluoro-8-prop-2-enoxy-7,8-dihydro-6H-quinolin-5-yl]propan-1-one (PubChem CID 160989894) has the molecular formula C21H20Cl2FNO2 and a molecular weight of 408.30 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-1-[(5S,8S)-5-fluoro-8-prop-2-enoxy-7,8-dihydro-6H-quinolin-5-yl]propan-1-one.
| Compound Name | 3-(2,4-dichlorophenyl)-1-[(5S,8S)-5-fluoro-8-prop-2-enoxy-7,8-dihydro-6H-quinolin-5-yl]propan-1-one |
|---|---|
| PubChem CID | 160989894 |
| Molecular Formula | C21H20Cl2FNO2 |
| Molecular Weight | 408.30 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-1-[(5S,8S)-5-fluoro-8-prop-2-enoxy-7,8-dihydro-6H-quinolin-5-yl]propan-1-one |
| SMILES | C=CCO[C@H]1CC[C@@](F)(C(=O)CCc2ccc(Cl)cc2Cl)c2cccnc21 |
| InChI | InChI=1S/C21H20Cl2FNO2/c1-2-12-27-18-9-10-21(24,16-4-3-11-25-20(16)18)19(26)8-6-14-5-7-15(22)13-17(14)23/h2-5,7,11,13,18H,1,6,8-10,12H2/t18-,21-/m0/s1 |
| InChIKey | TUMBXJANLZLDPD-RXVVDRJESA-N |
| XLogP | 5.79 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.30 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|