C10H11F2N — CID 138501498
(8S)-5,5-difluoro-8-methyl-7,8-dihydro-6H-quinoline (PubChem CID 138501498) has the molecular formula C10H11F2N and a molecular weight of 183.20 g/mol. Its IUPAC name is (8S)-5,5-difluoro-8-methyl-7,8-dihydro-6H-quinoline.
| Compound Name | (8S)-5,5-difluoro-8-methyl-7,8-dihydro-6H-quinoline |
|---|---|
| PubChem CID | 138501498 |
| Molecular Formula | C10H11F2N |
| Molecular Weight | 183.20 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | (8S)-5,5-difluoro-8-methyl-7,8-dihydro-6H-quinoline |
| SMILES | C[C@H]1CCC(F)(F)c2cccnc21 |
| InChI | InChI=1S/C10H11F2N/c1-7-4-5-10(11,12)8-3-2-6-13-9(7)8/h2-3,6-7H,4-5H2,1H3/t7-/m0/s1 |
| InChIKey | KNXGSWWWSSNKDZ-ZETCQYMHSA-N |
| XLogP | 3.07 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.20 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |