About methyl (5R,8S)-8-hydroxy-5-methyl-7,8-dihydro-6H-quinoline-5-carboxylate
methyl (5R,8S)-8-hydroxy-5-methyl-7,8-dihydro-6H-quinoline-5-carboxylate (PubChem CID 148941310) has the molecular formula C12H15NO3
and a molecular weight of 221.26 g/mol. Its IUPAC name is methyl (5R,8S)-8-hydroxy-5-methyl-7,8-dihydro-6H-quinoline-5-carboxylate.
Molecular Properties
| Compound Name | methyl (5R,8S)-8-hydroxy-5-methyl-7,8-dihydro-6H-quinoline-5-carboxylate |
| PubChem CID | 148941310 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | methyl (5R,8S)-8-hydroxy-5-methyl-7,8-dihydro-6H-quinoline-5-carboxylate |
| SMILES | COC(=O)[C@]1(C)CC[C@H](O)c2ncccc21 |
| InChI | InChI=1S/C12H15NO3/c1-12(11(15)16-2)6-5-9(14)10-8(12)4-3-7-13-10/h3-4,7,9,14H,5-6H2,1-2H3/t9-,12+/m0/s1 |
| InChIKey | PNYOOOPOMDMYPJ-JOYOIKCWSA-N |
| XLogP | 1.34 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (5R,8S)-8-hydroxy-5-methyl-7,8-dihydro-6H-quinoline-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (5R,8S)-8-hydroxy-5-methyl-7,8-dihydro-6H-quinoline-5-carboxylate?
The IUPAC name of methyl (5R,8S)-8-hydroxy-5-methyl-7,8-dihydro-6H-quinoline-5-carboxylate (CID 148941310) is methyl (5R,8S)-8-hydroxy-5-methyl-7,8-dihydro-6H-quinoline-5-carboxylate.
What is the SMILES notation for methyl (5R,8S)-8-hydroxy-5-methyl-7,8-dihydro-6H-quinoline-5-carboxylate?
The canonical SMILES for methyl (5R,8S)-8-hydroxy-5-methyl-7,8-dihydro-6H-quinoline-5-carboxylate is COC(=O)[C@]1(C)CC[C@H](O)c2ncccc21.
What is the InChIKey of methyl (5R,8S)-8-hydroxy-5-methyl-7,8-dihydro-6H-quinoline-5-carboxylate?
The InChIKey is PNYOOOPOMDMYPJ-JOYOIKCWSA-N. The full InChI is InChI=1S/C12H15NO3/c1-12(11(15)16-2)6-5-9(14)10-8(12)4-3-7-13-10/h3-4,7,9,14H,5-6H2,1-2H3/t9-,12+/m0/s1.
What are the key properties of methyl (5R,8S)-8-hydroxy-5-methyl-7,8-dihydro-6H-quinoline-5-carboxylate?
methyl (5R,8S)-8-hydroxy-5-methyl-7,8-dihydro-6H-quinoline-5-carboxylate has a molecular weight of 221.26 g/mol, XLogP of 1.34, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (5R,8S)-8-hydroxy-5-methyl-7,8-dihydro-6H-quinoline-5-carboxylate is sourced from PubChem (CID 148941310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).