C9H12N2 — CID 86311748
(8R)-8-methyl-5,6,7,8-tetrahydro-1,6-naphthyridine (PubChem CID 86311748) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is (8R)-8-methyl-5,6,7,8-tetrahydro-1,6-naphthyridine.
| Compound Name | (8R)-8-methyl-5,6,7,8-tetrahydro-1,6-naphthyridine |
|---|---|
| PubChem CID | 86311748 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | (8R)-8-methyl-5,6,7,8-tetrahydro-1,6-naphthyridine |
| SMILES | C[C@@H]1CNCc2cccnc21 |
| InChI | InChI=1S/C9H12N2/c1-7-5-10-6-8-3-2-4-11-9(7)8/h2-4,7,10H,5-6H2,1H3/t7-/m1/s1 |
| InChIKey | ZNOZHRNLWDCANL-SSDOTTSWSA-N |
| XLogP | 1.29 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |