C9H9F2NO — CID 84718894
4,4-difluoro-2,3-dihydro-1H-isoquinolin-8-ol (PubChem CID 84718894) has the molecular formula C9H9F2NO and a molecular weight of 185.17 g/mol. Its IUPAC name is 4,4-difluoro-2,3-dihydro-1H-isoquinolin-8-ol.
| Compound Name | 4,4-difluoro-2,3-dihydro-1H-isoquinolin-8-ol |
|---|---|
| PubChem CID | 84718894 |
| Molecular Formula | C9H9F2NO |
| Molecular Weight | 185.17 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 4,4-difluoro-2,3-dihydro-1H-isoquinolin-8-ol |
| SMILES | Oc1cccc2c1CNCC2(F)F |
| InChI | InChI=1S/C9H9F2NO/c10-9(11)5-12-4-6-7(9)2-1-3-8(6)13/h1-3,12-13H,4-5H2 |
| InChIKey | CAUTWGXOKKCTIS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.17 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|