C10H13NO2 — CID 105438006
4-(hydroxymethyl)-1,2,3,4-tetrahydroisoquinolin-8-ol (PubChem CID 105438006) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 4-(hydroxymethyl)-1,2,3,4-tetrahydroisoquinolin-8-ol.
| Compound Name | 4-(hydroxymethyl)-1,2,3,4-tetrahydroisoquinolin-8-ol |
|---|---|
| PubChem CID | 105438006 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 4-(hydroxymethyl)-1,2,3,4-tetrahydroisoquinolin-8-ol |
| SMILES | OCC1CNCc2c(O)cccc21 |
| InChI | InChI=1S/C10H13NO2/c12-6-7-4-11-5-9-8(7)2-1-3-10(9)13/h1-3,7,11-13H,4-6H2 |
| InChIKey | MHAPSGPKKHBZSU-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|