C10H13NO — CID 82277392
(7-methyl-2,3-dihydro-1H-indol-3-yl)methanol (PubChem CID 82277392) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is (7-methyl-2,3-dihydro-1H-indol-3-yl)methanol.
| Compound Name | (7-methyl-2,3-dihydro-1H-indol-3-yl)methanol |
|---|---|
| PubChem CID | 82277392 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (7-methyl-2,3-dihydro-1H-indol-3-yl)methanol |
| SMILES | Cc1cccc2c1NCC2CO |
| InChI | InChI=1S/C10H13NO/c1-7-3-2-4-9-8(6-12)5-11-10(7)9/h2-4,8,11-12H,5-6H2,1H3 |
| InChIKey | FUISTBOHHJYFCG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |