C11H15NO2 — CID 105447033
4-(2-hydroxyethyl)-1,2,3,4-tetrahydroisoquinolin-8-ol (PubChem CID 105447033) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 4-(2-hydroxyethyl)-1,2,3,4-tetrahydroisoquinolin-8-ol.
| Compound Name | 4-(2-hydroxyethyl)-1,2,3,4-tetrahydroisoquinolin-8-ol |
|---|---|
| PubChem CID | 105447033 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 4-(2-hydroxyethyl)-1,2,3,4-tetrahydroisoquinolin-8-ol |
| SMILES | OCCC1CNCc2c(O)cccc21 |
| InChI | InChI=1S/C11H15NO2/c13-5-4-8-6-12-7-10-9(8)2-1-3-11(10)14/h1-3,8,12-14H,4-7H2 |
| InChIKey | ZZKCSLJLYKSKAI-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|