C12H15BrO — CID 57052297
5-(2-bromoethyl)-5,6,7,8-tetrahydronaphthalen-1-ol (PubChem CID 57052297) has the molecular formula C12H15BrO and a molecular weight of 255.15 g/mol. Its IUPAC name is 5-(2-bromoethyl)-5,6,7,8-tetrahydronaphthalen-1-ol.
| Compound Name | 5-(2-bromoethyl)-5,6,7,8-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 57052297 |
| Molecular Formula | C12H15BrO |
| Molecular Weight | 255.15 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 5-(2-bromoethyl)-5,6,7,8-tetrahydronaphthalen-1-ol |
| SMILES | Oc1cccc2c1CCCC2CCBr |
| InChI | InChI=1S/C12H15BrO/c13-8-7-9-3-1-5-11-10(9)4-2-6-12(11)14/h2,4,6,9,14H,1,3,5,7-8H2 |
| InChIKey | XVYPUUHXGZTFHA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.15 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|