C12H13NO2 — CID 112709876
5-(isocyanatomethyl)-5,6,7,8-tetrahydronaphthalen-1-ol (PubChem CID 112709876) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 5-(isocyanatomethyl)-5,6,7,8-tetrahydronaphthalen-1-ol.
| Compound Name | 5-(isocyanatomethyl)-5,6,7,8-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 112709876 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 5-(isocyanatomethyl)-5,6,7,8-tetrahydronaphthalen-1-ol |
| SMILES | O=C=NCC1CCCc2c(O)cccc21 |
| InChI | InChI=1S/C12H13NO2/c14-8-13-7-9-3-1-5-11-10(9)4-2-6-12(11)15/h2,4,6,9,15H,1,3,5,7H2 |
| InChIKey | NWWIBHBZRLHWGX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|