C11H10FNO — CID 83829688
4-fluoro-1-(isocyanatomethyl)-2,3-dihydro-1H-indene (PubChem CID 83829688) has the molecular formula C11H10FNO and a molecular weight of 191.21 g/mol. Its IUPAC name is 4-fluoro-1-(isocyanatomethyl)-2,3-dihydro-1H-indene.
| Compound Name | 4-fluoro-1-(isocyanatomethyl)-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 83829688 |
| Molecular Formula | C11H10FNO |
| Molecular Weight | 191.21 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 4-fluoro-1-(isocyanatomethyl)-2,3-dihydro-1H-indene |
| SMILES | O=C=NCC1CCc2c(F)cccc21 |
| InChI | InChI=1S/C11H10FNO/c12-11-3-1-2-9-8(6-13-7-14)4-5-10(9)11/h1-3,8H,4-6H2 |
| InChIKey | YEBUKDYEXFVUII-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.21 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|