C12H9BrN2OS — CID 115285760
6-bromo-3-thiophen-2-yl-3,4-dihydro-1H-quinoxalin-2-one (PubChem CID 115285760) has the molecular formula C12H9BrN2OS and a molecular weight of 309.19 g/mol. Its IUPAC name is 6-bromo-3-thiophen-2-yl-3,4-dihydro-1H-quinoxalin-2-one.
| Compound Name | 6-bromo-3-thiophen-2-yl-3,4-dihydro-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 115285760 |
| Molecular Formula | C12H9BrN2OS |
| Molecular Weight | 309.19 g/mol |
| Exact Mass | 307.96 |
| IUPAC Name | 6-bromo-3-thiophen-2-yl-3,4-dihydro-1H-quinoxalin-2-one |
| SMILES | O=C1Nc2ccc(Br)cc2NC1c1cccs1 |
| InChI | InChI=1S/C12H9BrN2OS/c13-7-3-4-8-9(6-7)14-11(12(16)15-8)10-2-1-5-17-10/h1-6,11,14H,(H,15,16) |
| InChIKey | ZUTXSBFJHUWUGA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.19 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |