C10H10N4O2S — CID 4780164
4-thiophen-2-yl-1,3,4,6,7,8-hexahydropyrimido[4,5-d]pyridazine-2,5-dione (PubChem CID 4780164) has the molecular formula C10H10N4O2S and a molecular weight of 250.28 g/mol. Its IUPAC name is 4-thiophen-2-yl-1,3,4,6,7,8-hexahydropyrimido[4,5-d]pyridazine-2,5-dione.
| Compound Name | 4-thiophen-2-yl-1,3,4,6,7,8-hexahydropyrimido[4,5-d]pyridazine-2,5-dione |
|---|---|
| PubChem CID | 4780164 |
| Molecular Formula | C10H10N4O2S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 4-thiophen-2-yl-1,3,4,6,7,8-hexahydropyrimido[4,5-d]pyridazine-2,5-dione |
| SMILES | O=C1NC2=C(C(=O)NNC2)C(c2cccs2)N1 |
| InChI | InChI=1S/C10H10N4O2S/c15-9-7-5(4-11-14-9)12-10(16)13-8(7)6-2-1-3-17-6/h1-3,8,11H,4H2,(H,14,15)(H2,12,13,16) |
| InChIKey | FTTMNFDBNDAUKB-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |