C10H8N4O3S — CID 102085485
5-thiophen-2-yl-1,5,6,8-tetrahydropyrimido[4,5-d]pyrimidine-2,4,7-trione (PubChem CID 102085485) has the molecular formula C10H8N4O3S and a molecular weight of 264.27 g/mol. Its IUPAC name is 5-thiophen-2-yl-1,5,6,8-tetrahydropyrimido[4,5-d]pyrimidine-2,4,7-trione.
| Compound Name | 5-thiophen-2-yl-1,5,6,8-tetrahydropyrimido[4,5-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 102085485 |
| Molecular Formula | C10H8N4O3S |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 5-thiophen-2-yl-1,5,6,8-tetrahydropyrimido[4,5-d]pyrimidine-2,4,7-trione |
| SMILES | O=C1Nc2[nH]c(=O)[nH]c(=O)c2C(c2cccs2)N1 |
| InChI | InChI=1S/C10H8N4O3S/c15-8-5-6(4-2-1-3-18-4)11-9(16)12-7(5)13-10(17)14-8/h1-3,6H,(H4,11,12,13,14,15,16,17) |
| InChIKey | UKKZZZYCXGPHCX-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |