C15H17N3O2S — CID 95706511
(4S)-1-cyclopentyl-4-thiophen-2-yl-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridine-3,6-dione (PubChem CID 95706511) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is (4S)-1-cyclopentyl-4-thiophen-2-yl-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridine-3,6-dione.
| Compound Name | (4S)-1-cyclopentyl-4-thiophen-2-yl-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridine-3,6-dione |
|---|---|
| PubChem CID | 95706511 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | (4S)-1-cyclopentyl-4-thiophen-2-yl-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridine-3,6-dione |
| SMILES | O=C1C[C@H](c2cccs2)c2c(n(C3CCCC3)[nH]c2=O)N1 |
| InChI | InChI=1S/C15H17N3O2S/c19-12-8-10(11-6-3-7-21-11)13-14(16-12)18(17-15(13)20)9-4-1-2-5-9/h3,6-7,9-10H,1-2,4-5,8H2,(H,16,19)(H,17,20)/t10-/m1/s1 |
| InChIKey | ASWLTMDBVYPVBY-SNVBAGLBSA-N |
| XLogP | 2.83 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |