C17H13N3OS2 — CID 23966374
7-phenyl-2-sulfanylidene-5-thiophen-2-yl-5,8-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one (PubChem CID 23966374) has the molecular formula C17H13N3OS2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 7-phenyl-2-sulfanylidene-5-thiophen-2-yl-5,8-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 7-phenyl-2-sulfanylidene-5-thiophen-2-yl-5,8-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 23966374 |
| Molecular Formula | C17H13N3OS2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 7-phenyl-2-sulfanylidene-5-thiophen-2-yl-5,8-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)[nH]c2c1C(c1cccs1)C=C(c1ccccc1)N2 |
| InChI | InChI=1S/C17H13N3OS2/c21-16-14-11(13-7-4-8-23-13)9-12(10-5-2-1-3-6-10)18-15(14)19-17(22)20-16/h1-9,11H,(H3,18,19,20,21,22) |
| InChIKey | WSZBWRKKDZMILT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|