C13H12N2OS2 — CID 892758
N-(thiophen-2-ylmethylcarbamothioyl)benzamide (PubChem CID 892758) has the molecular formula C13H12N2OS2 and a molecular weight of 276.39 g/mol. Its IUPAC name is N-(thiophen-2-ylmethylcarbamothioyl)benzamide.
| Compound Name | N-(thiophen-2-ylmethylcarbamothioyl)benzamide |
|---|---|
| PubChem CID | 892758 |
| Molecular Formula | C13H12N2OS2 |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | N-(thiophen-2-ylmethylcarbamothioyl)benzamide |
| SMILES | O=C(NC(=S)NCc1cccs1)c1ccccc1 |
| InChI | InChI=1S/C13H12N2OS2/c16-12(10-5-2-1-3-6-10)15-13(17)14-9-11-7-4-8-18-11/h1-8H,9H2,(H2,14,15,16,17) |
| InChIKey | LTAWCHATRSDECJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|