C13H11BrN2OS2 — CID 54791822
3-bromo-N-(thiophen-2-ylmethylcarbamothioyl)benzamide (PubChem CID 54791822) has the molecular formula C13H11BrN2OS2 and a molecular weight of 355.28 g/mol. Its IUPAC name is 3-bromo-N-(thiophen-2-ylmethylcarbamothioyl)benzamide.
| Compound Name | 3-bromo-N-(thiophen-2-ylmethylcarbamothioyl)benzamide |
|---|---|
| PubChem CID | 54791822 |
| Molecular Formula | C13H11BrN2OS2 |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 353.95 |
| IUPAC Name | 3-bromo-N-(thiophen-2-ylmethylcarbamothioyl)benzamide |
| SMILES | O=C(NC(=S)NCc1cccs1)c1cccc(Br)c1 |
| InChI | InChI=1S/C13H11BrN2OS2/c14-10-4-1-3-9(7-10)12(17)16-13(18)15-8-11-5-2-6-19-11/h1-7H,8H2,(H2,15,16,17,18) |
| InChIKey | VVVYUTYRYBGFRU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|