C9H12N2O2S2 — CID 2824600
ethyl N-(thiophen-2-ylmethylcarbamothioyl)carbamate (PubChem CID 2824600) has the molecular formula C9H12N2O2S2 and a molecular weight of 244.34 g/mol. Its IUPAC name is ethyl N-(thiophen-2-ylmethylcarbamothioyl)carbamate.
| Compound Name | ethyl N-(thiophen-2-ylmethylcarbamothioyl)carbamate |
|---|---|
| PubChem CID | 2824600 |
| Molecular Formula | C9H12N2O2S2 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | ethyl N-(thiophen-2-ylmethylcarbamothioyl)carbamate |
| SMILES | CCOC(=O)NC(=S)NCc1cccs1 |
| InChI | InChI=1S/C9H12N2O2S2/c1-2-13-9(12)11-8(14)10-6-7-4-3-5-15-7/h3-5H,2,6H2,1H3,(H2,10,11,12,14) |
| InChIKey | LIWKLEGRUCGPJA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|